(-)-6-Deoxyerythronolide B
TL;DR: (-)-6-Deoxyerythronolide B (CAS 15797-36-1) is a chemical compound with molecular formula C21H38O6 and molecular weight 386.26685 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-14-ethyl-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione
Also Known As: 6-deoxyerythronolide B, 6-Desoxyerythronolid B, Erythromycin Impurity 51, 3,5,11-Trihydroxyerythranolid-9-one, (-)-6-Deoxyerythronolide B
Technical Specifications
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.26685 g/mol |
| XLogP | 3.1 |
| Topological Polar Surface Area (TPSA) | 104.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Exact Mass | 386.26685 Da |
| Heavy Atoms | 27 |
| Complexity | 507.0 |
| SMILES | CC[C@@H]1[C@@H]([C@@H]([C@H](C(=O)[C@@H](C[C@@H]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O)C)O)C)C)C)O)C |
| InChIKey | HQZOLNNEQAKEHT-IBBGRPSASA-N |
Chemical Property Profile of (-)-6-Deoxyerythronolide B
Property Insights of (-)-6-Deoxyerythronolide B
The XLogP value of 3.1 indicates that (-)-6-Deoxyerythronolide B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 104.0 Ų falls within the moderate polarity range, balancing permeability and solubility for (-)-6-Deoxyerythronolide B. Following Lipinski's Rule of Five, (-)-6-Deoxyerythronolide B has 3 hydrogen bond donor(s) and 6 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of (-)-6-Deoxyerythronolide B?
The CAS number of (-)-6-Deoxyerythronolide B is 15797-36-1.
What is the molecular formula of (-)-6-Deoxyerythronolide B?
The molecular formula of (-)-6-Deoxyerythronolide B is C21H38O6.
What is the molecular weight of (-)-6-Deoxyerythronolide B?
The molecular weight of (-)-6-Deoxyerythronolide B is 386.26685 g/mol.
Where can I buy (-)-6-Deoxyerythronolide B?
You can request a quote for (-)-6-Deoxyerythronolide B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for (-)-6-Deoxyerythronolide B?
Yes, CoreyChem provides custom synthesis services for (-)-6-Deoxyerythronolide B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.