Anolignan B
TL;DR: Anolignan B (CAS 158081-98-2) is a chemical compound with molecular formula C18H18O2 and molecular weight 266.13068 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
4-[3-[(4-hydroxyphenyl)methyl]-2-methylidenebut-3-enyl]phenol
Also Known As: Anolignan B, 2,3-Bis-(4-hydroxybenzyl)-1,3-butadiene, 2,3-Bis(4-hydroxybenzyl)-1,3-butadiene, 2,3-bis(4-hydroxybenzyl)-1 ,3-butadiene, 4-[3-[(4-hydroxyphenyl)methyl]-2-methylidenebut-3-enyl]phenol
Technical Specifications
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.13068 g/mol |
| XLogP | 5.5 |
| Topological Polar Surface Area (TPSA) | 40.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 266.13068 Da |
| Heavy Atoms | 20 |
| Complexity | 297.0 |
| SMILES | C=C(CC1=CC=C(C=C1)O)C(=C)CC2=CC=C(C=C2)O |
| InChIKey | VVKZAZVVUAFFGF-UHFFFAOYSA-N |
Chemical Property Profile of Anolignan B
Property Insights of Anolignan B
The XLogP value of 5.5 indicates that Anolignan B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 40.5 Ų, Anolignan B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Anolignan B has 2 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Anolignan B?
The CAS number of Anolignan B is 158081-98-2.
What is the molecular formula of Anolignan B?
The molecular formula of Anolignan B is C18H18O2.
What is the molecular weight of Anolignan B?
The molecular weight of Anolignan B is 266.13068 g/mol.
Where can I buy Anolignan B?
You can request a quote for Anolignan B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Anolignan B?
Yes, CoreyChem provides custom synthesis services for Anolignan B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.