Cylindrol B
TL;DR: Cylindrol B (CAS 165187-16-6) is a chemical compound with molecular formula C23H30O4 and molecular weight 370.21442 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
2,4-dihydroxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]benzaldehyde
Also Known As: Cylindrol B, 2,4-dihydroxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]benzaldehyde, 2,4-dihydroxy-6-methyl-3-((2E,4E)-3-methyl-5-((1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl)penta-2,4-dienyl)benzaldehyde, 2,4-dihydroxy-6-methyl-3-{3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dien-1-yl}benzaldehyde, 3-[3-Methyl-5-(1,2beta,6beta-trimethyl-3-oxocyclohexan-1alpha-yl)-2,4-pentadienyl]-2,4-dihydroxy-6-methylbenzaldehyde
Technical Specifications
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.21442 g/mol |
| XLogP | 5.6 |
| Topological Polar Surface Area (TPSA) | 74.6 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 370.21442 Da |
| Heavy Atoms | 27 |
| Complexity | 607.0 |
| SMILES | C[C@@H]1CCC(=O)[C@@H]([C@@]1(C)/C=C/C(=C/CC2=C(C=C(C(=C2O)C=O)C)O)/C)C |
| InChIKey | AQCKKGIVKOHRLM-HBFAXEOFSA-N |
Chemical Property Profile of Cylindrol B
Property Insights of Cylindrol B
The XLogP value of 5.6 indicates that Cylindrol B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 74.6 Ų falls within the moderate polarity range, balancing permeability and solubility for Cylindrol B. Following Lipinski's Rule of Five, Cylindrol B has 2 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Cylindrol B?
The CAS number of Cylindrol B is 165187-16-6.
What is the molecular formula of Cylindrol B?
The molecular formula of Cylindrol B is C23H30O4.
What is the molecular weight of Cylindrol B?
The molecular weight of Cylindrol B is 370.21442 g/mol.
Where can I buy Cylindrol B?
You can request a quote for Cylindrol B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Cylindrol B?
Yes, CoreyChem provides custom synthesis services for Cylindrol B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.