N-[(E)-(3-chlorophenyl)methylidene]-4-(diphenylmethyl)piperazin-1-amine
(E)-N-(4-benzhydrylpiperazin-1-yl)-1-(3-chlorophenyl)methanimine
Also Known As: CBMicro_033338|BIM-0033359.P001|(E)-4-benzhydryl-N-(3-chlorobenzylidene)piperazin-1-amine|N-(4-benzhydrylpiperazin-1-yl)-1-(3-chlorophenyl)methanimine|(E)-N-(4-benzhydrylpiperazin-1-yl)-1-(3-chlorophenyl)methanimine|N-(4-benzhydryl-1-piperazinyl)-N-[(E)-(3-chlorophenyl)methylidene]amine|N-[(E)-(3-chlorophenyl)methylidene]-4-(diphenylmethyl)piperazin-1-amine
| Molecular Formula | C24H24ClN3 |
|---|---|
| Molecular Weight | 389.16586 g/mol |
| LogP | 5.0811 |
| Topological Polar Surface Area | 18.84 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 389.16586 |
| Monoisotopic Mass | 389.16586 |
| Heavy Atoms | 28 |
| Complexity | 863.90295 |
Chemical Identifiers
| CAS Number | 1697-46-7 |
|---|---|
| SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)/N=C/C4=CC(=CC=C4)Cl |
Product Overview
N-[(E)-(3-chlorophenyl)methylidene]-4-(diphenylmethyl)piperazin-1-amine (CAS 1697-46-7), with molecular formula C24H24ClN3 and molecular weight 389.16586 g/mol. IUPAC: (E)-N-(4-benzhydrylpiperazin-1-yl)-1-(3-chlorophenyl)methanimine.
N-[(E)-(3-chlorophenyl)methylidene]-4-(diphenylmethyl)piperazin-1-amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »