Silane, (4-chlorophenoxy)trimethyl-
(4-chlorophenoxy)-trimethylsilane
Also Known As: (4-Chlorophenoxy)trimethylsilane|Phenol, 4-chloro, TMS|4-ClC6H4OSiMe3|Silane, (4-chlorophenoxy)trimethyl-|4-Chlorophenol, TMS derivative|p-chlorophenoxy trimethylsilane|(4-chlorophenoxy)(trimethyl)silane|Trimethyl(4-chlorophenoxy)silane|(4-chlorophenoxy)-trimethylsilane|(4-Chlorophenoxy)tri(methyl)silane|(4-CHLOROPHENOXY)TRIISOPROPYLSILANE|4-Chloro-1-trimethylsilyloxybenzene|4-Chlorophenyl(trimethylsilyl) ether|(4-Chloro-phenoxy)-trimethyl-silane|1-(Trimethylsilyloxy)-4-chlorobenzene|SILANE,(4-CHLOROPHENOXY),TRIMETHYL|J1.659.742B
| Molecular Formula | C9H13ClOSi |
|---|---|
| Molecular Weight | 200.04242 g/mol |
| LogP | 3.5537 |
| Topological Polar Surface Area | 9.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 200.04242 |
| Monoisotopic Mass | 200.04242 |
| Heavy Atoms | 12 |
| Complexity | 136.0 |
Chemical Identifiers
| CAS Number | 17005-59-3 |
|---|---|
| SMILES | C[Si](C)(C)OC1=CC=C(C=C1)Cl |
| InChIKey | CJDREQROIGYMMO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Silane, (4-chlorophenoxy)trimethyl- (CAS 17005-59-3), with molecular formula C9H13ClOSi and molecular weight 200.04242 g/mol. IUPAC: (4-chlorophenoxy)-trimethylsilane.
Silane, (4-chlorophenoxy)trimethyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »