Ethyl 2-methyl-6-phenylpyridine-3-carboxylate
ethyl 2-methyl-6-phenylpyridine-3-carboxylate
Also Known As: Ethyl 2-methyl-6-phenylpyridine-3-carboxylate|Ethyl 2-methyl-6-phenylnicotinate|METHYLDECANOATE|Ethyl2-methyl-6-phenylnicotinate|Ethyl 2-methyl-6-phenyl-pyridine-3-carboxylate|RW1409|Ethyl2-methyl-6-phenylpyridine-3-carboxylate|2-phenyl-5-ethoxycarbonyl-6-methylpyridine|2-Methyl-6-phenylnicotinic acid ethyl ester|J1.782.100H|702E143|2-Methyl-6-phenylpyridi-3-carboxylic acid ethyl ester|I14-11858|2-Methyl-6-phenyl-3-pyridinecarboxylic acid ethyl ester|2-Methyl-6-phenylpyridine-3-carboxylic acid ethyl ester|2-Methyl-6-phenyl-pyridine-3-carboxylic acid ethyl ester|3-Pyridinecarboxylicacid, 2-methyl-6-phenyl-, ethyl ester|2-Methyl-6-phenyl-3-pyridinecarboxylic acid ethyl ester, 97% - 10MG 10mg
| Molecular Formula | C15H15NO2 |
|---|---|
| Molecular Weight | 241.11028 g/mol |
| LogP | 3.23372 |
| Topological Polar Surface Area | 39.19 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 241.11028 |
| Monoisotopic Mass | 241.11028 |
| Heavy Atoms | 18 |
| Complexity | 549.675 |
Chemical Identifiers
| CAS Number | 1702-14-3 |
|---|---|
| SMILES | CCOC(=O)C1=C(N=C(C=C1)C2=CC=CC=C2)C |
Product Overview
Ethyl 2-methyl-6-phenylpyridine-3-carboxylate (CAS 1702-14-3), with molecular formula C15H15NO2 and molecular weight 241.11028 g/mol. IUPAC: ethyl 2-methyl-6-phenylpyridine-3-carboxylate.