Vernomycin B
TL;DR: Vernomycin B (CAS 17226-75-4) is a chemical compound with molecular formula C19H20O10 and molecular weight 408.10565 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
4-methoxy-7-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]furo[3,2-g]chromen-5-one
Also Known As: Khellinin, Khellol glucoside, Khellosid, VERNOMYCIN B, DISOXARIL
Technical Specifications
| Molecular Formula | C19H20O10 |
| Molecular Weight | 408.10565 g/mol |
| XLogP | -0.6 |
| Topological Polar Surface Area (TPSA) | 148.0 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Exact Mass | 408.10565 Da |
| Heavy Atoms | 29 |
| Complexity | 638.0 |
| SMILES | COC1=C2C=COC2=CC3=C1C(=O)C=C(O3)COC4C(C(C(C(O4)CO)O)O)O |
| InChIKey | SJRACCTZSAUMGO-UHFFFAOYSA-N |
Chemical Property Profile of Vernomycin B
Property Insights of Vernomycin B
The XLogP value of -0.6 indicates that Vernomycin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 148.0 Ų indicates high polarity, suggesting Vernomycin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Vernomycin B has 4 hydrogen bond donor(s) and 10 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of Vernomycin B?
The CAS number of Vernomycin B is 17226-75-4.
What is the molecular formula of Vernomycin B?
The molecular formula of Vernomycin B is C19H20O10.
What is the molecular weight of Vernomycin B?
The molecular weight of Vernomycin B is 408.10565 g/mol.
Where can I buy Vernomycin B?
You can request a quote for Vernomycin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Vernomycin B?
Yes, CoreyChem provides custom synthesis services for Vernomycin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.