2'-Nitro-2-biphenylcarboxylic acid
2-(2-nitrophenyl)benzoic acid
Also Known As: 2-(2-nitrophenyl)benzoic acid|2'-Nitro-2-biphenylcarboxylic acid|[1,2'-nitro|[1, 2'-nitro-|Oprea1_708878|CBDivE_002809|2'-nitrobiphenyl-2-carboxylic acid|[1,1'-Biphenyl]-2-carboxylicacid, 2'-nitro-|2'-NITRO-[1,1'-BIPHENYL]-2-CARBOXYLIC ACID|2-Biphenylcarboxylic acid, 2'-nitro-|2'-Nitro[1,1'-biphenyl]-2-carboxylic acid|[1,1'-Biphenyl]-2-carboxylic acid, 2'-nitro-|2 -Nitro-1,1 -biphenyl-2-carboxylic acid|2'-NITRO-[1,1'-BIPHENYL]-2-CARBOXYLICACID|SR-01000392965-1
| Molecular Formula | C13H9NO4 |
|---|---|
| Molecular Weight | 243.05316 g/mol |
| LogP | 2.4 |
| Topological Polar Surface Area | 83.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 243.05316 |
| Monoisotopic Mass | 243.05316 |
| Heavy Atoms | 18 |
| Complexity | 325.0 |
Chemical Identifiers
| CAS Number | 17294-89-2 |
|---|---|
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2[N+](=O)[O-])C(=O)O |
| InChIKey | OBCFFNURIFARKS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2'-Nitro-2-biphenylcarboxylic acid (CAS 17294-89-2), with molecular formula C13H9NO4 and molecular weight 243.05316 g/mol. IUPAC: 2-(2-nitrophenyl)benzoic acid.