Benzene, 1,3-dichloro-2-fluoro-5-(trifluoromethyl)-
1,3-dichloro-2-fluoro-5-(trifluoromethyl)benzene
Also Known As: 3,5-Dichloro-4-fluorobenzotrifluoride|1,3-dichloro-2-fluoro-5-(trifluoromethyl)benzene|2-Chloro-5-cyanobenzotrifluoride|WT161|Benzene, 1,3-dichloro-2-fluoro-5-(trifluoromethyl)-|3,5-dichloro-4-flurobenzotriflouride|3,5-dichloro-4-chlorobenzotrifluoride|3,5-dichloro-4-fluorobenzotriflouride|AC-4132|3,5-dichloro-4-fluoro-benzotrifluoride|P767|3,5-Dichloro-4-fluorobenzotrifluoride, 98%|4CH-002542|J1.591.143C|27D817|Q-9410
| Molecular Formula | C7H2Cl2F4 |
|---|---|
| Molecular Weight | 231.94698 g/mol |
| LogP | 4.2 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 231.94698 |
| Monoisotopic Mass | 231.94698 |
| Heavy Atoms | 13 |
| Complexity | 170.0 |
Chemical Identifiers
| CAS Number | 1735-54-2 |
|---|---|
| SMILES | C1=C(C=C(C(=C1Cl)F)Cl)C(F)(F)F |
| InChIKey | BWQFQKZDLBJZAW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzene, 1,3-dichloro-2-fluoro-5-(trifluoromethyl)- (CAS 1735-54-2), with molecular formula C7H2Cl2F4 and molecular weight 231.94698 g/mol. IUPAC: 1,3-dichloro-2-fluoro-5-(trifluoromethyl)benzene.