2,2-Bis(trifluoromethyl)propanoyl fluoride
3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride
Also Known As: 2,2-Bis(trifluoromethyl)propionyl fluoride|3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride|2,2-Bis(trifluoromethyl)propanoyl fluoride|PC0203|PENTAFLUOROPROPIONALDEHYDEHYDRATE|2,2-Bis(trifluoromethyl)propionylfluoride|2,2-bis(trifluoromethyl)propionic acid fluoride|3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propionyl fluoride|3,3,3-Trifluoro-2-methyl-2-trifluoromethyl-propionyl fluoride|Propanoyl fluoride, 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)-|695-213-4
| Molecular Formula | C5H3F7O |
|---|---|
| Molecular Weight | 212.00722 g/mol |
| LogP | 2.6134 |
| Topological Polar Surface Area | 17.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 212.00722 |
| Monoisotopic Mass | 212.00722 |
| Heavy Atoms | 13 |
| Complexity | 197.90324 |
Chemical Identifiers
| CAS Number | 1735-87-1 |
|---|---|
| SMILES | CC(C(=O)F)(C(F)(F)F)C(F)(F)F |
Product Overview
2,2-Bis(trifluoromethyl)propanoyl fluoride (CAS 1735-87-1), with molecular formula C5H3F7O and molecular weight 212.00722 g/mol. IUPAC: 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride.
2,2-Bis(trifluoromethyl)propanoyl fluoride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »