(4-Bromophenyl)(phenyl)methanamine
(4-bromophenyl)-phenylmethanamine
Also Known As: (4-bromophenyl)(phenyl)methanamine|alpha-(4-Bromophenyl)benzylamine|(4-bromophenyl)-phenylmethanamine|(4-bromophenyl)phenylmethylamine|(4-bromophenyl)(phenyl)methylamine|(4-bromophenyl)-phenyl-methanamine|1-(4-bromophenyl)-1-phenylmethanamine|KS-000009II|ZERO/005450|(4-bromophenyl)(phenyl) methanamine|(R)-(4-BROMOPHENYL)(PHENYL)METHANAMINE|(S)-(4-BROMOPHENYL)(PHENYL)METHANAMINE|Benzenemethanamine, 4-bromo-.alpha.-phenyl-|(1R)-1-(4-bromophenyl)-1-phenylmethanamine|(1S)-1-(4-bromophenyl)-1-phenylmethanamine|[(4-BROMOPHENYL)(PHENYL)METHYL]AMINE|K-9869
| Molecular Formula | C13H12BrN |
|---|---|
| Molecular Weight | 261.01532 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 26.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 261.01532 |
| Monoisotopic Mass | 261.01532 |
| Heavy Atoms | 15 |
| Complexity | 181.0 |
Chemical Identifiers
| CAS Number | 1736-74-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Br)N |
| InChIKey | CUGXLVXNFZFUFF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(4-Bromophenyl)(phenyl)methanamine (CAS 1736-74-9), with molecular formula C13H12BrN and molecular weight 261.01532 g/mol. IUPAC: (4-bromophenyl)-phenylmethanamine.
(4-Bromophenyl)(phenyl)methanamine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »