1-(Difluorophenylmethyl)-4-methylbenzene
1-[difluoro(phenyl)methyl]-4-methylbenzene
Also Known As: 1-(difluorophenylmethyl)-4-methylbenzene|1-[difluoro(phenyl)methyl]-4-methylbenzene|4-(difluoro-phenyl-methyl)-toluene|Difluorophenyl(4-methylphenyl)methane|1-(Difluoro(phenyl)methyl)-4-methylbenzene|1-(difluoro-phenyl-methyl)-4-methyl-benzene|1-[difluoro(phenyl)methyl]-4-methyl-benzene|Benzene, 1-(difluorophenylmethyl)-4-methyl-|7-methylcarboxylate-1H-quinazoline-2,4-dione|J1.781.131B|Z-0056|AU-004/43508155|N/A
| Molecular Formula | C14H12F2 |
|---|---|
| Molecular Weight | 218.09071 g/mol |
| LogP | 4.13512 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 2 |
| Exact Mass | 218.09071 |
| Monoisotopic Mass | 218.09071 |
| Heavy Atoms | 16 |
| Complexity | 457.85382 |
Chemical Identifiers
| CAS Number | 174075-29-7 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(F)F |
Product Overview
1-(Difluorophenylmethyl)-4-methylbenzene (CAS 174075-29-7), with molecular formula C14H12F2 and molecular weight 218.09071 g/mol. IUPAC: 1-[difluoro(phenyl)methyl]-4-methylbenzene.
1-(Difluorophenylmethyl)-4-methylbenzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »