ethyl (Z)-3-anilinobut-2-enoate
ethyl (Z)-3-anilinobut-2-enoate
Also Known As: Ethyl 3-anilinocrotonate|ethyl (Z)-3-anilinobut-2-enoate|ethyl 3-anilinobut-2-enoate|Ethyl beta-anilinocrotonate|ethyl 3-phenylaminocrotonate|ethyl (2Z)-3-(phenylamino)but-2-enoate|EINECS 228-518-4|ethyl (2Z)-3-anilino-2-butenoate|(E)-ethyl 3-(phenylamino)but-2-enoate|AI3-10029|Crotonic acid, 3-anilino-, ethyl ester|3-(Phenylamino)crotonic acid ethyl ester|(Z)-3-anilino-2-butenoic acid ethyl ester|(Z)-3-(Phenylamino)crotonic acid ethyl ester|2-Butenoic acid, 3-(phenylamino)-, ethyl ester|(Z)-3-(Phenylamino)-2-butenoic acid ethyl ester|F3307-0023
| Molecular Formula | C12H15NO2 |
|---|---|
| Molecular Weight | 205.11028 g/mol |
| LogP | 2.5654 |
| Topological Polar Surface Area | 38.33 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 205.11028 |
| Monoisotopic Mass | 205.11028 |
| Heavy Atoms | 15 |
| Complexity | 343.89957 |
Chemical Identifiers
| CAS Number | 17469-23-7 |
|---|---|
| SMILES | CCOC(=O)/C=C(/C)\NC1=CC=CC=C1 |
Product Overview
ethyl (Z)-3-anilinobut-2-enoate (CAS 17469-23-7), with molecular formula C12H15NO2 and molecular weight 205.11028 g/mol. IUPAC: ethyl (Z)-3-anilinobut-2-enoate.