Ethanol, 2-(tert-butyl((5-chlorobenzo(b)thien-3-yl)methyl)amino)-, hydrochloride
2-[tert-butyl-[(5-chloro-1-benzothiophen-3-yl)methyl]amino]ethanol;hydrochloride
Also Known As: Ethanol, 2-(tert-butyl((5-chlorobenzo(b)thien-3-yl)methyl)amino)-, hydrochloride|2-(tert-Butyl((5-chlorobenzo(b)thien-3-yl)methyl)amino)ethanol hydrochloride|Ethanol, 2-(((5-chlorobenzo(b)thien-3-yl)methyl)(1,1-dimethylethyl)amino)-, hydrochloride|2-[tert-butyl-[(5-chloro-1-benzothiophen-3-yl)methyl]amino]ethanol hydrochloride|2-{tert-Butyl[(5-chloro-1-benzothiophen-3-yl)methyl]amino}ethan-1-ol--hydrogen chloride (1/1)
| Molecular Formula | C15H21Cl2NOS |
|---|---|
| Molecular Weight | 333.07208 g/mol |
| LogP | 4.5693 |
| Topological Polar Surface Area | 51.7 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 333.07208 |
| Monoisotopic Mass | 333.07208 |
| Heavy Atoms | 20 |
| Complexity | 294.0 |
Chemical Identifiers
| CAS Number | 17512-30-0 |
|---|---|
| SMILES | CC(C)(C)N(CCO)CC1=CSC2=C1C=C(C=C2)Cl.Cl |
| InChIKey | QYBYHDGXOLKPRZ-UHFFFAOYSA-N |
Product Overview
Ethanol, 2-(tert-butyl((5-chlorobenzo(b)thien-3-yl)methyl)amino)-, hydrochloride (CAS 17512-30-0), with molecular formula C15H21Cl2NOS and molecular weight 333.07208 g/mol. IUPAC: 2-[tert-butyl-[(5-chloro-1-benzothiophen-3-yl)methyl]amino]ethanol;hydrochloride.