Methyl 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetate
methyl 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetate
Also Known As: methyl 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetate|Maybridge1_002190|HMS547L12|BUTTPARK 37\06-82|Methyl 2-(5-methyl-2-phenylthiazol-4-yl)acetate|Fr13582|methyl (5-methyl-2-phenylthiazol-4-yl)acetate|4-Thiazoleaceticacid, 5-methyl-2-phenyl-, methyl ester|Methyl (5-methyl-2-phenyl-1,3-thiazol-4-yl)acetate|5-methyl-2-phenyl4-thiazoleacetic acid methyl ester|methyl 2-(5-methyl-2-phenyl thiazol-4-yl)acetate|methyl 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethanoate|methyl 2-(5-methyl-2-phenyl-thiazol-4-yl)acetate|I14-40005|4-Thiazoleacetic acid, 5-methyl-2-phenyl-, methyl ester|2-[5-methyl-2-phenyl-1,3-thiazol-4-yl]acetic acid methyl ester|B8E
| Molecular Formula | C13H13NO2S |
|---|---|
| Molecular Weight | 247.0667 g/mol |
| LogP | 2.83402 |
| Topological Polar Surface Area | 39.19 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 247.0667 |
| Monoisotopic Mass | 247.0667 |
| Heavy Atoms | 17 |
| Complexity | 519.47064 |
Chemical Identifiers
| CAS Number | 175136-29-5 |
|---|---|
| SMILES | CC1=C(N=C(S1)C2=CC=CC=C2)CC(=O)OC |
Product Overview
Methyl 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetate (CAS 175136-29-5), with molecular formula C13H13NO2S and molecular weight 247.0667 g/mol. IUPAC: methyl 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetate.