2-(Pentamethylbenzoyl)thiophene
(2,3,4,5,6-pentamethylphenyl)-thiophen-2-ylmethanone
Also Known As: 2-(Pentamethylbenzoyl)thiophene|Maybridge1_002886|DivK1c_001638|HMS549L04|(2,3,4,5,6-Pentamethylphenyl)(2-thienyl)methanone|CDS1_000598|(2,3,4,5,6-pentamethylphenyl)-thiophen-2-ylmethanone|(pentamethylphenyl)(thiophen-2-yl)methanone|2,3,4,5,6-pentamethylphenyl 2-thienyl ketone|Methanone, (2,3,4,5,6-pentamethylphenyl)-2-thienyl-|SR-01000643916-1|BRD-K67072466-001-01-9|I14-35240|Methanone,(2,3,4,5,6-pentamethylphenyl)-2-thienyl-|(2,3,4,5,6-Pentamethylphenyl)(2-thienyl)methanone #|(2,3,4,5,6-Pentamethylphenyl)(thiophen-2-yl)methanone
| Molecular Formula | C16H18OS |
|---|---|
| Molecular Weight | 258.10785 g/mol |
| LogP | 5.1 |
| Topological Polar Surface Area | 45.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 258.10785 |
| Monoisotopic Mass | 258.10785 |
| Heavy Atoms | 18 |
| Complexity | 298.0 |
Chemical Identifiers
| CAS Number | 175136-70-6 |
|---|---|
| SMILES | CC1=C(C(=C(C(=C1C)C)C(=O)C2=CC=CS2)C)C |
| InChIKey | ZGEZTRBQIJWTJL-UHFFFAOYSA-N |
Product Overview
2-(Pentamethylbenzoyl)thiophene (CAS 175136-70-6), with molecular formula C16H18OS and molecular weight 258.10785 g/mol. IUPAC: (2,3,4,5,6-pentamethylphenyl)-thiophen-2-ylmethanone.