Methyl 4-[(4-chlorophenyl)thio]thiophene-3-carboxylate
methyl 4-(4-chlorophenyl)sulfanylthiophene-3-carboxylate
Also Known As: Maybridge1_004941|methyl 4-[(4-chlorophenyl)thio]thiophene-3-carboxylate|HMS555I13|methyl 4-(4-chlorophenyl)sulfanylthiophene-3-carboxylate|KM 04847|methyl 4-[(4-chlorophenyl)sulfanyl]thiophene-3-carboxylate|Methyl 4-((4-chlorophenyl)thio)thiophene-3-carboxylate|3-Thiophenecarboxylic acid, 4-[(4-chlorophenyl)thio]-, methyl ester|I14-35067|Methyl 4[(4-chlorophenyl)thio]thiophene-3-carboxylate|1-Acetoxy-8-hydroxy-1,4,4a,9a-tetrahydroanthraquinone|3-Thiophenecarboxylicacid, 4-[(4-chlorophenyl)thio]-, methyl ester|4-(4-chlorophenylsulfanyl)thiophene-3-carboxylic acid methyl ester
| Molecular Formula | C12H9ClO2S2 |
|---|---|
| Molecular Weight | 283.97324 g/mol |
| LogP | 4.3393 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 283.97324 |
| Monoisotopic Mass | 283.97324 |
| Heavy Atoms | 17 |
| Complexity | 519.5568 |
Chemical Identifiers
| CAS Number | 175202-88-7 |
|---|---|
| SMILES | COC(=O)C1=CSC=C1SC2=CC=C(C=C2)Cl |
Product Overview
Methyl 4-[(4-chlorophenyl)thio]thiophene-3-carboxylate (CAS 175202-88-7), with molecular formula C12H9ClO2S2 and molecular weight 283.97324 g/mol. IUPAC: methyl 4-(4-chlorophenyl)sulfanylthiophene-3-carboxylate.