Ethyl 1-(4-chlorobenzyl)-5-methylimidazole-4-carboxylate
ethyl 1-[(4-chlorophenyl)methyl]-5-methylimidazole-4-carboxylate
Also Known As: Maybridge1_004767|ethyl 1-(4-chlorobenzyl)-5-methylimidazole-4-carboxylate|HMS555A15|ethyl 1-[(4-chlorophenyl)methyl]-5-methylimidazole-4-carboxylate|1H-Imidazole-4-carboxylicacid, 1-[(4-chlorophenyl)methyl]-5-methyl-, ethyl ester|Ethyl 1-[(4-chlorophenyl)methyl]-5-methyl-4-imidazolidinecarboxylate|1H-Imidazole-4-carboxylic acid, 1-[(4-chlorophenyl)methyl]-5-methyl-, ethyl ester|4-Imidazolidinecarboxylic acid, 1-[(4-chlorophenyl)methyl]-5-methyl-, ethyl ester
| Molecular Formula | C14H15ClN2O2 |
|---|---|
| Molecular Weight | 278.0822 g/mol |
| LogP | 3.06992 |
| Topological Polar Surface Area | 44.12 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 278.0822 |
| Monoisotopic Mass | 278.0822 |
| Heavy Atoms | 19 |
| Complexity | 575.63196 |
Chemical Identifiers
| CAS Number | 175202-89-8 |
|---|---|
| SMILES | CCOC(=O)C1=C(N(C=N1)CC2=CC=C(C=C2)Cl)C |
Product Overview
Ethyl 1-(4-chlorobenzyl)-5-methylimidazole-4-carboxylate (CAS 175202-89-8), with molecular formula C14H15ClN2O2 and molecular weight 278.0822 g/mol. IUPAC: ethyl 1-[(4-chlorophenyl)methyl]-5-methylimidazole-4-carboxylate.