![2-[5-(2-Chloroacetyl)-2-thienyl]acetic acid structure](/static/products/1752/175203-15-3.webp)
2-[5-(2-Chloroacetyl)-2-thienyl]acetic acid
2-[5-(2-chloroacetyl)thiophen-2-yl]acetic acid
Also Known As: 2-[5-(2-chloroacetyl)-2-thienyl]acetic acid|SOLVENTRED146|2-[5-(2-chloroacetyl)thiophen-2-yl]acetic Acid|5-(chloroacetyl)thiophene-2-acetic acid|BUTTPARK 93\04-18|2-(5-(2-Chloroacetyl)thiophen-2-yl)acetic acid|2-Thiopheneacetic acid, 5-(2-chloroacetyl)-|[5-(Chloroacetyl)thiophen-2-yl]acetic acid|2-Thiopheneaceticacid, 5-(2-chloroacetyl)-|[5-(2-Chloro-acetyl)-thiophene-2-yl]-acetic acid|[5-(2-chloroacetyl)thiophen-2-yl]acetic acid|K-5370|2-(5-(2-Chloroacetyl)thiophen-2-yl)aceticacid|2-Thiopheneacetic acid, 5-(chloroacetyl)- (9CI)|I14-35054
| Molecular Formula | C8H7ClO3S |
|---|---|
| Molecular Weight | 217.98044 g/mol |
| LogP | 1.7967 |
| Topological Polar Surface Area | 54.37 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 217.98044 |
| Monoisotopic Mass | 217.98044 |
| Heavy Atoms | 13 |
| Complexity | 331.88507 |
Chemical Identifiers
| CAS Number | 175203-15-3 |
|---|---|
| SMILES | C1=C(SC(=C1)C(=O)CCl)CC(=O)O |
Product Overview
2-[5-(2-Chloroacetyl)-2-thienyl]acetic acid (CAS 175203-15-3), with molecular formula C8H7ClO3S and molecular weight 217.98044 g/mol. IUPAC: 2-[5-(2-chloroacetyl)thiophen-2-yl]acetic acid.