5-(3,5-Bis(trifluoromethyl)phenyl)-2H-tetrazole
5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole
Also Known As: 5-[3,5-Bis(trifluoromethyl)phenyl]tetrazole|5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole|KG-548|Maybridge1_006968|YSZCJ001|5-(3,5-bis(trifluoromethyl)phenyl)-1H-tetrazole|Activator 42(R) 0.3 M|HMS561E16|2H-Tetrazole, 5-[3,5-bis(trifluoromethyl)phenyl]-|3-fluoro-5-(trifluoromethyl)aniline|5-[3,5-Bis(trifluoromethyl)phenyl]-1H-tetrazole|5-[3,5-bis(trifluoromethyl)phenyl]-2H-1,2,3,4-tetrazole|5-(3,5-bis(trifluoromethyl)phenyl)-2H-tetrazole|BB 0259663|1H-Tetrazole, 5-[3,5-bis(trifluoromethyl)phenyl]-|5-[3,5-Bis(trifluoromethyl)phenyl]-2H-tetraazole #|BRD-K64480308-001-01-9
| Molecular Formula | C9H4F6N4 |
|---|---|
| Molecular Weight | 282.03403 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 54.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Exact Mass | 282.03403 |
| Monoisotopic Mass | 282.03403 |
| Heavy Atoms | 19 |
| Complexity | 295.0 |
Chemical Identifiers
| CAS Number | 175205-09-1 |
|---|---|
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C2=NNN=N2 |
| InChIKey | KKJFZIQEWZVVIV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
5-(3,5-Bis(trifluoromethyl)phenyl)-2H-tetrazole (CAS 175205-09-1), with molecular formula C9H4F6N4 and molecular weight 282.03403 g/mol. IUPAC: 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole.