2,3-dimethyl-1H-indole-5-carbohydrazide
2,3-dimethyl-1H-indole-5-carbohydrazide
Also Known As: 2,3-dimethyl-1H-indole-5-carbohydrazide|Oprea1_018496|Oprea1_528785|2,3-Dimethyl-1H-indole-5-carboxylic acid hydrazide|2,3-dimethylindole-5-carbohydrazide|5-chlorothiophene-2-sulfonohydrazide|3,5-Dichloro-4-iodobenzotrifluoride|4546AE|2,3-dimethyl-1 h-indole-5-carboxylic acid hydrazide|1H-Indole-5-carboxylicacid, 2,3-dimethyl-, hydrazide|BAS 03154505|2,3-dimethyl-1h-indole-5-carboxylic acidhydrazide|2,3-dimethyl-indole-5-carboxylic acid hydrazide|SR-01000319126-1|2,3-Dimethyl-1 H -indole-5-carboxylic acid hydrazide
| Molecular Formula | C11H13N3O |
|---|---|
| Molecular Weight | 203.10587 g/mol |
| LogP | 1.38824 |
| Topological Polar Surface Area | 70.91 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 203.10587 |
| Monoisotopic Mass | 203.10587 |
| Heavy Atoms | 15 |
| Complexity | 527.8577 |
Chemical Identifiers
| CAS Number | 175205-56-8 |
|---|---|
| SMILES | CC1=C(NC2=C1C=C(C=C2)C(=O)NN)C |
Product Overview
2,3-dimethyl-1H-indole-5-carbohydrazide (CAS 175205-56-8), with molecular formula C11H13N3O and molecular weight 203.10587 g/mol. IUPAC: 2,3-dimethyl-1H-indole-5-carbohydrazide.
2,3-dimethyl-1H-indole-5-carbohydrazide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »