Methyl 3-[(2-methoxy-2-oxoethyl)thio]-3-(2-thienyl)propanoate
methyl 3-(2-methoxy-2-oxoethyl)sulfanyl-3-thiophen-2-ylpropanoate
Also Known As: methyl 3-[(2-methoxy-2-oxoethyl)thio]-3-(2-thienyl)propanoate|methyl 3-(2-methoxy-2-oxoethyl)sulfanyl-3-thiophen-2-ylpropanoate|I14-35063|2-Thiophenepropanoic acid, beta-[(2-methoxy-2-oxoethyl)thio]-, methyl ester|methyl 3-[(2-methoxy-2-oxoethyl)sulfanyl]-3-(thiophen-2-yl)propanoate|2-Thiophenepropanoicacid, b-[(2-methoxy-2-oxoethyl)thio]-, methyl ester|METHYL,3-[(2-METHOXY-2-OXOETHYL)THIO]-3-(2-THIENYL)PROPANOATE|METHYL3-[(2-METHOXY-2-OXOETHYL)THIO]-3-(2-THIENYL)PROPANOATE
| Molecular Formula | C11H14O4S2 |
|---|---|
| Molecular Weight | 274.03336 g/mol |
| LogP | 2.2585 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Exact Mass | 274.03336 |
| Monoisotopic Mass | 274.03336 |
| Heavy Atoms | 17 |
| Complexity | 361.55817 |
Chemical Identifiers
| CAS Number | 175276-43-4 |
|---|---|
| SMILES | COC(=O)CC(C1=CC=CS1)SCC(=O)OC |
Product Overview
Methyl 3-[(2-methoxy-2-oxoethyl)thio]-3-(2-thienyl)propanoate (CAS 175276-43-4), with molecular formula C11H14O4S2 and molecular weight 274.03336 g/mol. IUPAC: methyl 3-(2-methoxy-2-oxoethyl)sulfanyl-3-thiophen-2-ylpropanoate.