5-Methyl-2-(Trifluoromethyl)Furan-3-Carbonyl Chloride
5-methyl-2-(trifluoromethyl)furan-3-carbonyl chloride
Also Known As: 5-methyl-2-(trifluoromethyl)furan-3-carbonyl chloride|HMS565A07|5-Methyl-2-(trifluoromethyl)furan-3-carbonylchloride|5-Methyl-2-(trifluoromethyl)-3-furoyl chloride|FS-6258|3-Furancarbonylchloride, 5-methyl-2-(trifluoromethyl)-|5-Methyl-2-(trifluoromethyl)-3-furoyl chloride,tech.|I14-40008|3-Furancarbonyl chloride, 5-methyl-2-(trifluoromethyl)- (9CI)|5-methyl-2-(trifluoromethyl)furan-3-carbonyl chloride, AldrichCPR|109-002-7|5-Methyl-2-(trifluoromethyl)furan-3-carbonyl chloride, 3-(Chlorocarbonyl)-5-methyl-2-(trifluoromethyl)furan
| Molecular Formula | C7H4ClF3O2 |
|---|---|
| Molecular Weight | 211.9852 g/mol |
| LogP | 2.98582 |
| Topological Polar Surface Area | 30.21 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 211.9852 |
| Monoisotopic Mass | 211.9852 |
| Heavy Atoms | 13 |
| Complexity | 339.99713 |
Chemical Identifiers
| CAS Number | 175276-66-1 |
|---|---|
| SMILES | CC1=CC(=C(O1)C(F)(F)F)C(=O)Cl |
Product Overview
5-Methyl-2-(Trifluoromethyl)Furan-3-Carbonyl Chloride (CAS 175276-66-1), with molecular formula C7H4ClF3O2 and molecular weight 211.9852 g/mol. IUPAC: 5-methyl-2-(trifluoromethyl)furan-3-carbonyl chloride.