2-Bromo-4-(trifluoromethoxy)aniline
2-bromo-4-(trifluoromethoxy)aniline
Also Known As: 2-Bromo-4-(trifluoromethoxy)aniline|2-Bromo-4-trifluoromethoxyaniline|Riluzole Impurity 5|2-bromo-4-tirfluoromethoxyaniline|Benzenamine, 2-bromo-4-(trifluoromethoxy)-|ACMC-1C8K7|4-Amino-3-bromobenzotrifluoride|2-Bromo-4-trifluoromethoxy-phenylamine|TIMTEC-BB SBB000789|BUTTPARK 44\03-51|BUTTPARK 83\07-26|4-(Trifluoromethoxy)benzyl alcohol|WT205|2-bromo-4(trifluoromethoxy)aniline|2-Bromo-4-(trifluoromethyl)aniline|KS-000009VY|2-bromo-4-trifluoromethyl-phenylamine|AN-6298|CS-W012568|PS-7408|2-bromo-4-(trifluoromethoxy)phenylamine
| Molecular Formula | C7H5BrF3NO |
|---|---|
| Molecular Weight | 254.95065 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 35.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 254.95065 |
| Monoisotopic Mass | 254.95065 |
| Heavy Atoms | 13 |
| Complexity | 176.0 |
Chemical Identifiers
| CAS Number | 175278-17-8 |
|---|---|
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)N |
| InChIKey | ROSTYHNIIDIBEG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Bromo-4-(trifluoromethoxy)aniline (CAS 175278-17-8), with molecular formula C7H5BrF3NO and molecular weight 254.95065 g/mol. IUPAC: 2-bromo-4-(trifluoromethoxy)aniline.