4-amino-3-(trifluoromethoxy)benzoic Acid
4-amino-3-(trifluoromethoxy)benzoic acid
Also Known As: 4-amino-3-(trifluoromethoxy)benzoic Acid|4-amino-3-trifluoromethoxybenzoic acid|Benzoic acid, 4-amino-3-(trifluoromethoxy)-|ACMC-209e9s|BUTTPARK 83\07-32|RARECHEM AL BO 0798|4-Amino-3-trifluoromethoxy benzoic acid|PARAGOS 530294|KS-00000FGM|WT105|3-(trifluoromethoxy)-4-aminobenzoicacid|2-Bromo-4-(trifluoromethoxy)aniline|CA-723|CL8103|FC1104|4-Amine-3-(trifluoromethoxy)Benzoic acid|4-Amino-3-trifluoromethoxybenzoicacid|4-Carboxy-2-(trifluoromethoxy)aniline|AN-9559|CS-W014741|PS-7852|4-amino-3-trifluoromethoxy-benzoic acid|(S)-1-benzyl-3-hydroxypiperidin-2-one|3-(Trifluoromethoxy)-4-aminobenzoic acid
| Molecular Formula | C8H6F3NO3 |
|---|---|
| Molecular Weight | 221.02998 g/mol |
| LogP | 1.8656 |
| Topological Polar Surface Area | 72.55 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 221.02998 |
| Monoisotopic Mass | 221.02998 |
| Heavy Atoms | 15 |
| Complexity | 389.20856 |
Chemical Identifiers
| CAS Number | 175278-22-5 |
|---|---|
| SMILES | C1=CC(=C(C=C1C(=O)O)OC(F)(F)F)N |
Product Overview
4-amino-3-(trifluoromethoxy)benzoic Acid (CAS 175278-22-5), with molecular formula C8H6F3NO3 and molecular weight 221.02998 g/mol. IUPAC: 4-amino-3-(trifluoromethoxy)benzoic acid.