4-(5-Chlorocarbonyl-furan-2-yl)-benzoic acid ethyl ester
ethyl 4-(5-carbonochloridoylfuran-2-yl)benzoate
Also Known As: ACMC-20amvh|4-(5-Chlorocarbonyl-furan-2-yl)-benzoic acid ethyl ester|ethyl 4-(5-chlorocarbonyl-2-furyl)benzoate|Ethyl 4-(5-(chlorocarbonyl)furan-2-yl)benzoate|ASISCHEM B52620|2-(Difluoromethoxy)Bromobenzene|4- -BENZOICACIDETHYLESTER|ethyl 4-(5-carbonochloridoylfuran-2-yl)benzoate|ethyl 4-[5-(carbonochloridoyl)furan-2-yl]benzoate|BAS 01409275|ethyl 4-[5-(chlorocarbonyl)furan-2-yl]benzoate|ethyl 4-(5-(chlorocarbonyl)-2-furyl)benzoate|Ethyl4-(5-(chlorocarbonyl)furan-2-yl)benzoate|I14-61344|4-(5-chlorocarbonylfuran-2-yl)benzoic acid ethyl ester|Benzoic acid,4-[5-(chlorocarbonyl)-2-furanyl]-, ethyl ester
| Molecular Formula | C14H11ClO4 |
|---|---|
| Molecular Weight | 278.03458 g/mol |
| LogP | 3.5023 |
| Topological Polar Surface Area | 56.51 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 278.03458 |
| Monoisotopic Mass | 278.03458 |
| Heavy Atoms | 19 |
| Complexity | 598.16345 |
Chemical Identifiers
| CAS Number | 175278-33-8 |
|---|---|
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC=C(O2)C(=O)Cl |
Product Overview
4-(5-Chlorocarbonyl-furan-2-yl)-benzoic acid ethyl ester (CAS 175278-33-8), with molecular formula C14H11ClO4 and molecular weight 278.03458 g/mol. IUPAC: ethyl 4-(5-carbonochloridoylfuran-2-yl)benzoate.