Bis(trimethylsilyl)lactate
trimethylsilyl 2-trimethylsilyloxypropanoate
Also Known As: Bis(trimethylsilyl)lactate|Lactic acid, di-TMS|Lactic acid, bis-TMS|Lactic acid, (2TMS)|Lactic acid, O,O-TMS|Lactic Acid, 2TMS derivative|o,o-Bis(trimethylsilyl)lactate|Propionic acid, 2-(trimethylsiloxy)-, trimethylsilyl ester|trimethylsilyl 2-trimethylsilyloxypropanoate|TRIMETHYLSILYL TRIMETHYLSILOXY LACTATE|Trimethylsilyl 2-[(trimethylsilyl)oxy]propanoate|Lactic acid, bis(trimethylsilyl)oxy-, ester|Propanoic acid, 2-[(trimethylsilyl)oxy]-, trimethylsilyl ester|Trimethylsilyl 2-((trimethylsilyl)oxy)propanoate|2-Trimethylsilyloxypropionic acid,trimethylsilyl ester|(2-trimethylsilyloxy)propionate de trimethylsilyle|2-(Trimethylsiloxy)propanoic acid trimethylsilyl ester|2-[(trimethylsilyl)oxy]propanoic acid trimethylsilyl ester|Propanoic acid, 2-((trimethylsilyl)oxy)-, trimethylsilyl ester|TRIMETHYLSILYL TRIMETHYLSILOXY LACTATE; 2-(Trimethylsiloxy)propanoic acid trimethylsilyl ester; (2-trimethylsilyloxy)propionate de trimethylsilyle; di-Trimethylsilyl-milchsaeure;
| Molecular Formula | C9H22O3Si2 |
|---|---|
| Molecular Weight | 234.11075 g/mol |
| LogP | 2.6045 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 234.11075 |
| Monoisotopic Mass | 234.11075 |
| Heavy Atoms | 14 |
| Complexity | 203.0 |
Chemical Identifiers
| CAS Number | 17596-96-2 |
|---|---|
| SMILES | CC(C(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChIKey | HXRGKEOWDNVHPA-UHFFFAOYSA-N |
Product Overview
Bis(trimethylsilyl)lactate (CAS 17596-96-2), with molecular formula C9H22O3Si2 and molecular weight 234.11075 g/mol. IUPAC: trimethylsilyl 2-trimethylsilyloxypropanoate.