(4-Bromo-2-isopropyl-5-methylphenoxy)acetic acid
2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetic acid
Also Known As: 4-bromothymoxyacetic acid|(4-bromo-2-isopropyl-5-methylphenoxy)acetic acid|2-(4-bromo-2-isopropyl-5-methylphenoxy)acetic acid|VU0509214-1|Y-1577|F3099-0624|2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetic acid|(4-Bromo-2-isopropyl-5-methyl-phenoxy)-acetic acid|2-(4-bromo-2-isopropyl-5-methylphenoxy)aceticacid|2-(4-bromo-5-methyl-2-propan-2-yl-phenoxy)acetic Acid|2-[4-bromo-5-methyl-2-(methylethyl)phenoxy]acetic acid
| Molecular Formula | C12H15BrO3 |
|---|---|
| Molecular Weight | 286.02045 g/mol |
| LogP | 3.7 |
| Topological Polar Surface Area | 46.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 286.02045 |
| Monoisotopic Mass | 286.02045 |
| Heavy Atoms | 16 |
| Complexity | 242.0 |
Chemical Identifiers
| CAS Number | 17693-39-9 |
|---|---|
| SMILES | CC1=CC(=C(C=C1Br)C(C)C)OCC(=O)O |
| InChIKey | PWFMMLDUJLXQOU-UHFFFAOYSA-N |
Product Overview
(4-Bromo-2-isopropyl-5-methylphenoxy)acetic acid (CAS 17693-39-9), with molecular formula C12H15BrO3 and molecular weight 286.02045 g/mol. IUPAC: 2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetic acid.
(4-Bromo-2-isopropyl-5-methylphenoxy)acetic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »