Phenyl Trimethylsilylmethyl Sulfone
benzenesulfonylmethyl(trimethyl)silane
Also Known As: Phenyl Trimethylsilylmethyl Sulfone|benzenesulfonylmethyl(trimethyl)silane|ACMC-209ees|(Phenylsulfonylmethyl)trimethylsilane|[(benzenesulfonyl)methyl]trimethylsilane|Benzene, [[(trimethylsilyl)methyl]sulfonyl]-|Trimethyl((phenylsulfonyl)methyl)silane|TRIMETHYLSILYLBENZENESULFONATE|(phenylsulfonyl)trimethylsilylmethane|Phenyl(trimethylsilylmethyl) sulfone|(Trimethylsilyl)methyl phenyl sulfone|Benzenesulfonylmethyl-trimethyl-silane|[(Benzenesulfonyl)methyl]tri(methyl)silane|4-isopropyl-2-methyl-4,5-dihydrothiazole|Benzene,[[(trimethylsilyl)methyl]sulfonyl]-|679-678-0
| Molecular Formula | C10H16O2SSi |
|---|---|
| Molecular Weight | 228.06403 g/mol |
| LogP | 2.3377 |
| Topological Polar Surface Area | 34.14 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 228.06403 |
| Monoisotopic Mass | 228.06403 |
| Heavy Atoms | 14 |
| Complexity | 389.88022 |
Chemical Identifiers
| CAS Number | 17872-92-3 |
|---|---|
| SMILES | C[Si](C)(C)CS(=O)(=O)C1=CC=CC=C1 |
Product Overview
Phenyl Trimethylsilylmethyl Sulfone (CAS 17872-92-3), with molecular formula C10H16O2SSi and molecular weight 228.06403 g/mol. IUPAC: benzenesulfonylmethyl(trimethyl)silane.