2-(3-fluoro-4-methylphenyl)-1H-isoindole-1,3(2H)-dione
2-(3-fluoro-4-methylphenyl)isoindole-1,3-dione
Also Known As: Oprea1_090445|Oprea1_743708|2-(3-fluoro-4-methylphenyl)isoindole-1,3-dione|KS-000049KG|N-(3-fluoro-4-methylphenyl)phthalimide|2-(3-fluoro-4-methylphenyl)-1H-isoindole-1,3(2H)-dione|2-(3-fluoro-4-methylphenyl)-2,3-dihydro-1H-isoindole-1,3-dione|AB00080237-01|F1443-0271|AG-205/10565020|2-(3-fluoro-4-methylphenyl)isoindoline-1,3-dione|SR-01000405837-1|2-(3-fluoro-4-methylphenyl)benzo[c]azoline-1,3-dione|A1669/0071175|Xanthylium, 9-(2,5-dicarboxyphenyl)-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1)
| Molecular Formula | C15H10FNO2 |
|---|---|
| Molecular Weight | 255.06955 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 37.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 255.06955 |
| Monoisotopic Mass | 255.06955 |
| Heavy Atoms | 19 |
| Complexity | 374.0 |
Chemical Identifiers
| CAS Number | 180146-75-2 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C3=CC=CC=C3C2=O)F |
| InChIKey | WTSLOUCNAJODMM-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(3-fluoro-4-methylphenyl)-1H-isoindole-1,3(2H)-dione (CAS 180146-75-2), with molecular formula C15H10FNO2 and molecular weight 255.06955 g/mol. IUPAC: 2-(3-fluoro-4-methylphenyl)isoindole-1,3-dione.