1,1'-Methylenebis(2,4-dinitrobenzene)
1-[(2,4-dinitrophenyl)methyl]-2,4-dinitrobenzene
Also Known As: 2,2',4,4'-tetranitrodiphenylmethane|1-(2,4-dinitrobenzyl)-2,4-dinitrobenzene|1-[(2,4-dinitrophenyl)methyl]-2,4-dinitrobenzene|Bis(2,4-dinitrophenyl)methane|1,1'-methanediylbis(2,4-dinitrobenzene)|KST-1B1683|1,1'-Methylenebis(2,4-dinitrobenzene)|Benzene,1,1'-methylenebis[2,4-dinitro-|2,4,2',4'-Tetranitro-diphenylmethan|Benzene, 1,1'-methylenebis[2,4-dinitro-|1,1'-methylenebis(2,4-dinitro-benzene)|2,2',4,4'-Tetranitrodiphenylmethane|Bis(2,4-dinitrophenyl)methane; 1,1'-Methylenebis[2,4-dinitro-benzene; NSC 32297; NSC 48921
| Molecular Formula | C13H8N4O8 |
|---|---|
| Molecular Weight | 348.0342 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 183.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Exact Mass | 348.0342 |
| Monoisotopic Mass | 348.0342 |
| Heavy Atoms | 25 |
| Complexity | 500.0 |
Chemical Identifiers
| CAS Number | 1817-76-1 |
|---|---|
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
| InChIKey | MTDLIOADHKERAQ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,1'-Methylenebis(2,4-dinitrobenzene) (CAS 1817-76-1), with molecular formula C13H8N4O8 and molecular weight 348.0342 g/mol. IUPAC: 1-[(2,4-dinitrophenyl)methyl]-2,4-dinitrobenzene.