Pyruvamidoxime, N-(p-(bis(2-chloroethyl)amino)phenyl)-
N'-[4-[bis(2-chloroethyl)amino]phenyl]-N-hydroxy-2-oxopropanimidamide
Also Known As: N-(p-(Bis(2-chloroethyl)amino)phenyl)pyruvamidoxime|Pyruvamidoxime, N-(p-(bis(2-chloroethyl)amino)phenyl)-|alpha-p-(N,N-Bis-(2-chloroethyl)amino)phenylamino-alpha-isonitrosoacetone|N'-[4-[bis(2-chloroethyl)amino]phenyl]-N-hydroxy-2-oxopropanimidamide|N-[4-[Bis(2-chloroethyl)amino]phenyl]-2-oxopropanamide oxime|4-
| Molecular Formula | C13H17Cl2N3O2 |
|---|---|
| Molecular Weight | 317.0698 g/mol |
| LogP | 2.5684 |
| Topological Polar Surface Area | 64.93 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 317.0698 |
| Monoisotopic Mass | 317.0698 |
| Heavy Atoms | 20 |
| Complexity | 457.189 |
Chemical Identifiers
| CAS Number | 18237-80-4 |
|---|---|
| SMILES | CC(=O)C(=NC1=CC=C(C=C1)N(CCCl)CCCl)NO |
Product Overview
Pyruvamidoxime, N-(p-(bis(2-chloroethyl)amino)phenyl)- (CAS 18237-80-4), with molecular formula C13H17Cl2N3O2 and molecular weight 317.0698 g/mol. IUPAC: N'-[4-[bis(2-chloroethyl)amino]phenyl]-N-hydroxy-2-oxopropanimidamide.