Barium methacrylate
barium(2+);bis(2-methylprop-2-enoate)
Also Known As: Barium methacrylate|BARIUMMETHACRYLATE|barium(2+);2-methylprop-2-enoate|Methacrylic Acid, Barium Salt|barium bis(2-methylacrylate)|C4H6O2.1/2Ba|C4-H6-O2.1/2Ba|barium bis(2-methylprop-2-enoate)|2-Propenoic acid,2-methyl-, barium salt (2:1)|barium(2+); 2-methylprop-2-enoate|2-Propenoic acid, 2-methyl-, barium salt|4-Pyrimidinamine, 2-[[2-fluoro-4-[[(2-fluoro-3-nitrophenyl)methyl]sulfonyl]phenyl]thio]-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-6-(1-piperidinyl)-
| Molecular Formula | C8H10BaO4 |
|---|---|
| Molecular Weight | 307.96317 g/mol |
| LogP | -1.756 |
| Topological Polar Surface Area | 80.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 307.96317 |
| Monoisotopic Mass | 307.96317 |
| Heavy Atoms | 13 |
| Complexity | 78.0 |
Chemical Identifiers
| CAS Number | 183-03-9 |
|---|---|
| SMILES | CC(=C)C(=O)[O-].CC(=C)C(=O)[O-].[Ba+2] |
| InChIKey | DIPCOVJHNPLQRI-UHFFFAOYSA-L |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Barium methacrylate (CAS 183-03-9), with molecular formula C8H10BaO4 and molecular weight 307.96317 g/mol. IUPAC: barium(2+);bis(2-methylprop-2-enoate).