Fialuridine I-124
1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(124I)iodopyrimidine-2,4-dione
Also Known As: Fialuridine I-124|124I-Labeled FIAU|FIALURIDINE|124I-FIAU|(124I)FIAU|[124I]FIAU|2,4(1H,3H)-Pyrimidinedione, 1-(2-deoxy-2-fluoro-beta-d-arabinofuranosyl)-5-(iodo-(sup 124)i)-|2'-Fluoro-2'-deoxy-5'-[124I]iodo-1 -D-arabinofuranosyluracil|1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)-5-(~124~I)iodopyrimidine-2,4(1H,3H)-dione|1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodanylpyrimidine-2,4-dione|2,4(1H,3H)-PYRIMIDINEDIONE, 1-(2-DEOXY-2-FLUORO-.BETA.-D-ARABINOFURANOSYL)-5-(IODO-(SUP 124)I)-
| Molecular Formula | C9H10FIN2O5 |
|---|---|
| Molecular Weight | 368.9636 g/mol |
| LogP | -0.9 |
| Topological Polar Surface Area | 99.1 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Exact Mass | 368.9636 |
| Monoisotopic Mass | 368.9636 |
| Heavy Atoms | 18 |
| Complexity | 418.0 |
Chemical Identifiers
| CAS Number | 183293-72-3 |
|---|---|
| SMILES | C1=C(C(=O)NC(=O)N1[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)F)[124I] |
| InChIKey | IPVFGAYTKQKGBM-GDBQBOEPSA-N |
Product Overview
Fialuridine I-124 (CAS 183293-72-3), with molecular formula C9H10FIN2O5 and molecular weight 368.9636 g/mol. IUPAC: 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(124I)iodopyrimidine-2,4-dione.