N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide
N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide
Also Known As: N-Nitrosoephedrine|Ephedrine Impurity 2|N-nitroso-ephedrine|N-Nitroso Ephedrine|N-Nitroso-(-)-ephedrine|N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide|Benzenemethanol, alpha-[1-(methylnitrosoamino)ethyl]-, [R-(R*,S*)]|(alphaR)-alpha-[(1S)-1-(Methylnitrosoamino)ethyl]benzenemethanol|Benzenemethanol, ?-[1-(methylnitrosoamino)ethyl]-, [R-(R*,S*)]|N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous am|Benzenemethanol, alpha-[(1S)-1-(methylnitrosoamino)ethyl]-, (alphaR)-
| Molecular Formula | C10H14N2O2 |
|---|---|
| Molecular Weight | 194.10553 g/mol |
| LogP | 1.7217 |
| Topological Polar Surface Area | 52.9 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 194.10553 |
| Monoisotopic Mass | 194.10553 |
| Heavy Atoms | 14 |
| Complexity | 289.4333 |
Chemical Identifiers
| CAS Number | 1850-61-9 |
|---|---|
| SMILES | C[C@@H]([C@@H](C1=CC=CC=C1)O)N(C)N=O |
Product Overview
N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide (CAS 1850-61-9), with molecular formula C10H14N2O2 and molecular weight 194.10553 g/mol. IUPAC: N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide.