![5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidin-4(3H)-one structure](/static/products/1859/18593-46-9.webp)
5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidin-4(3H)-one
5,6-dimethyl-2-phenyl-3H-thieno[2,3-d]pyrimidin-4-one
Also Known As: CBMicro_038114|5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidin-4(3H)-one|5,6-dimethyl-2-phenyl-3H,4H-thieno[2,3-d]pyrimidin-4-one|5,6-dimethyl-2-phenyl-3H-thieno[2,3-d]pyrimidin-4-one|BIM-0038337.P001|J2.708.591A|AE-848/34489055|2-Phenyl-5,6-dimethylthieno[2,3-d]pyrimidine-4(3H)-one|5,6-dimethyl-2-phenyl-3-hydrothiopheno[2,3-d]pyrimidin-4-one
| Molecular Formula | C14H12N2OS |
|---|---|
| Molecular Weight | 256.06705 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 69.7 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 256.06705 |
| Monoisotopic Mass | 256.06705 |
| Heavy Atoms | 18 |
| Complexity | 376.0 |
Chemical Identifiers
| CAS Number | 18593-46-9 |
|---|---|
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)C3=CC=CC=C3)C |
| InChIKey | BAYOCOYPAILNCK-UHFFFAOYSA-N |
Product Overview
5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidin-4(3H)-one (CAS 18593-46-9), with molecular formula C14H12N2OS and molecular weight 256.06705 g/mol. IUPAC: 5,6-dimethyl-2-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidin-4(3H)-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »