phosphonium chloride structure](/static/products/187/1875-19-0.png)
[4-(Benzyloxy)benzyl](triphenyl)phosphonium chloride
triphenyl-[(4-phenylmethoxyphenyl)methyl]phosphanium chloride
Also Known As: 4-benzyloxybenzyltriphenylphosphonium chloride|4-benzyloxybenzyltriphenyl phosphonium chloride|(4-benzyloxybenzyl)triphenylphosphonium chloride|[4-(benzyloxy)benzyl](triphenyl)phosphonium chloride|[4-(benzyloxy)benzyl] (triphenyl)phosphonium chloride|Triphenyl-[(4-phenylmethoxyphenyl)methyl]phosphanium Chloride|Phosphonium, triphenyl[[4-(phenylmethoxy)phenyl]methyl]-, chloride
| Molecular Formula | C32H28ClOP |
|---|---|
| Molecular Weight | 494.15662 g/mol |
| LogP | 3.7637 |
| Topological Polar Surface Area | 9.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Exact Mass | 494.15662 |
| Monoisotopic Mass | 494.15662 |
| Heavy Atoms | 35 |
| Complexity | 512.0 |
Chemical Identifiers
| CAS Number | 1875-19-0 |
|---|---|
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5.[Cl-] |
| InChIKey | ZNDBERRZILXTHK-UHFFFAOYSA-M |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
[4-(Benzyloxy)benzyl](triphenyl)phosphonium chloride (CAS 1875-19-0), with molecular formula C32H28ClOP and molecular weight 494.15662 g/mol. IUPAC: triphenyl-[(4-phenylmethoxyphenyl)methyl]phosphanium chloride.