Diethyl (5-bromopentyl)propanedioate
diethyl 2-(5-bromopentyl)propanedioate
Also Known As: Diethyl (5-Bromopentyl)malonate|(5-Bromopentyl)malonic Acid Diethyl Ester|diethyl 2-(5-bromopentyl)malonate|Diethyl 2-(5-bromopentyl)propanedioate|ACMC-209eu8|1,3-diethyl 2-(5-bromopentyl)propanedioate|Diethyl (5-bromopentyl)propanedioate|Diethyl(5-bromopentyl)malonate|diethyl2-(5-bromopentyl)malonate|DIETHYL 5-BROMOAMYLMALONATE|KS-000013BJ|Propanedioic acid, 2-(5-bromopentyl)-, 1,3-diethyl ester|diethyl 2-(5-bromanylpentyl)propanedioate|(5-Bromophentyl)malonic acid diethyl ester|2-(5-bromopentyl)malonic acid diethyl ester|2-(5-bromopentyl)propanedioic acid diethyl ester|J2.485.270I|I14-92259|Propanedioic acid,2-(5-bromopentyl)-, 1,3-diethyl ester
| Molecular Formula | C12H21BrO4 |
|---|---|
| Molecular Weight | 308.06232 g/mol |
| LogP | 2.6841 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Exact Mass | 308.06232 |
| Monoisotopic Mass | 308.06232 |
| Heavy Atoms | 17 |
| Complexity | 212.54552 |
Chemical Identifiers
| CAS Number | 1906-95-2 |
|---|---|
| SMILES | CCOC(=O)C(CCCCCBr)C(=O)OCC |
Product Overview
Diethyl (5-bromopentyl)propanedioate (CAS 1906-95-2), with molecular formula C12H21BrO4 and molecular weight 308.06232 g/mol. IUPAC: diethyl 2-(5-bromopentyl)propanedioate.