Silane, trimethyl(1-phenylethenyl)-
trimethyl(1-phenylethenyl)silane
Also Known As: alpha-trimethylsilylstyrene|Silane, trimethyl(1-phenylethenyl)-|1-Phenylethenyltrimethylsilane|1-Trimethylsilylethenylbenzene|alpha-(Trimethylsilyl)styrene|trimethyl(1-phenylethenyl)silane|(1-Phenylvinyl)trimethylsilane|trimethyl(1-phenylvinyl)silane|Silane,trimethyl(1-phenylethenyl)-|(1-Phenylethenyl)trimethylsilane|[1-(Trimethylsilyl)vinyl]benzene|1-(Trimethylsilyl)-1-phenylethene|Trimethyl(1-phenylethen-1-yl)silane|Benzene,[1-(trimethylsilyl)ethenyl]-
| Molecular Formula | C11H16Si |
|---|---|
| Molecular Weight | 176.10213 g/mol |
| LogP | 3.5772 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 2 |
| Exact Mass | 176.10213 |
| Monoisotopic Mass | 176.10213 |
| Heavy Atoms | 12 |
| Complexity | 158.0 |
Chemical Identifiers
| CAS Number | 1923-01-9 |
|---|---|
| SMILES | C[Si](C)(C)C(=C)C1=CC=CC=C1 |
| InChIKey | WNAGIMQWCVOKKX-UHFFFAOYSA-N |
Product Overview
Silane, trimethyl(1-phenylethenyl)- (CAS 1923-01-9), with molecular formula C11H16Si and molecular weight 176.10213 g/mol. IUPAC: trimethyl(1-phenylethenyl)silane.
Silane, trimethyl(1-phenylethenyl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »