2-(3,4-dimethylphenyl)-1H-isoindole-1,3(2H)-dione
2-(3,4-dimethylphenyl)isoindole-1,3-dione
Also Known As: CBMicro_004893|2-(3,4-dimethylphenyl)-1H-isoindole-1,3(2H)-dione|Oprea1_422162|Oprea1_741511|2-(3,4-dimethylphenyl)isoindole-1,3-dione|N-(3,4-Dimethylphenyl)phthalimide|KS-00004CR7|2-(3,4-Dimethylphenyl)isoindoline-1,3-dione|BIM-0004808.P001|J3.019.277J|1H-Isoindole-1,3(2H)-dione, 2-(3,4-dimethylphenyl)-|2-(3,4-Dimethylphenyl)-2H-isoindole-1,3-dione|AE-848/32719038|2-(3,4-dimethylphenyl)benzo[c]azolidine-1,3-dione|2-(3,4-DIMETHYL-PHENYL)-ISOINDOLE-1,3-DIONE|2-(3,4-dimethylphenyl)-2,3-dihydro-1H-isoindole-1,3-dione
| Molecular Formula | C16H13NO2 |
|---|---|
| Molecular Weight | 251.09464 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 37.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 251.09464 |
| Monoisotopic Mass | 251.09464 |
| Heavy Atoms | 19 |
| Complexity | 368.0 |
Chemical Identifiers
| CAS Number | 19357-31-4 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C3=CC=CC=C3C2=O)C |
| InChIKey | FCEPCSYWHDFZMG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(3,4-dimethylphenyl)-1H-isoindole-1,3(2H)-dione (CAS 19357-31-4), with molecular formula C16H13NO2 and molecular weight 251.09464 g/mol. IUPAC: 2-(3,4-dimethylphenyl)isoindole-1,3-dione.