4-Chloro-4'-methyl-1,1'-biphenyl
1-chloro-4-(4-methylphenyl)benzene
Also Known As: 4-chloro-4'-methyl-1,1'-biphenyl|4-chloro-4'-methylbiphenyl|1-chloro-4-(4-methylphenyl)benzene|4'-chloro-4-methylbiphenyl|1-chloro-4-(p-tolyl)benzene|4 -Chloro-4-methylbiphenyl|4-Chloro,4 -methylbiphenyl|4-Chloro-4 -methylbiphenyl|4-Methyl-4 -chlorobiphenyl|Biphenyl, 4-chloro-4'-methyl-|4-Chloro-4/'-methyl-1,1/'-biphenyl|1-(4-chlorophenyl)-4-methyl-benzene|1,1'-Biphenyl, 4-chloro-4'-methyl-|4-CHLORO-4-METHYL-1,1-BIPHENYL|4-Chloro-4 -methyl-1,1 -biphenyl|BB 0223396|J1.136.532I|4-chloro-4 inverted exclamation mark(R)-methylbiphenyl
| Molecular Formula | C13H11Cl |
|---|---|
| Molecular Weight | 202.05493 g/mol |
| LogP | 4.31542 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 1 |
| Exact Mass | 202.05493 |
| Monoisotopic Mass | 202.05493 |
| Heavy Atoms | 14 |
| Complexity | 368.49347 |
Chemical Identifiers
| CAS Number | 19482-11-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)Cl |
Product Overview
4-Chloro-4'-methyl-1,1'-biphenyl (CAS 19482-11-2), with molecular formula C13H11Cl and molecular weight 202.05493 g/mol. IUPAC: 1-chloro-4-(4-methylphenyl)benzene.