Bromhexine Hydrochloride
2,4-dibromo-6-[[cyclohexyl(methyl)amino]methyl]aniline;hydrochloride
Also Known As: Bromhexine hydrochloride|Bromhexine HCl|Bisolvon|Auxit|Broncokin|Viscolyt|Quentan|Bromessina|Lisomucin|Bromhexine chloride|bromhexine|Ophtolsol|Ophtosol|Uranine|Bromohexine hydrochloride|Bisolvon hydrochloride|Bromessina [Italian]|Bromehexine hydrochloride|Bromhexine (hydrochloride)|Bisolvon (TN)|Bromohexine monohydrochloride|BROMBENZONIUM|Bromihexine hydrochloride|Hydrochloride, Bromhexine|NA 274|Bromhexine Monohydrochloride|Bromhexine hydrochloride CRS|Monohydrochloride, Bromhexine|Bromhexine hydrochloride 100g|SPECTRUM1503107|NA-274|HY-B0372AR
| Molecular Formula | C14H21Br2ClN2 |
|---|---|
| Molecular Weight | 409.976 g/mol |
| LogP | 4.9801 |
| Topological Polar Surface Area | 29.26 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 409.976 |
| Monoisotopic Mass | 411.97394 |
| Heavy Atoms | 19 |
| Complexity | 420.15216 |
Chemical Identifiers
| CAS Number | 1978-39-8 |
|---|---|
| SMILES | CN(CC1=C(C(=CC(=C1)Br)Br)N)C2CCCCC2.Cl |
Product Overview
Bromhexine Hydrochloride (CAS 1978-39-8), with molecular formula C14H21Br2ClN2 and molecular weight 409.976 g/mol. IUPAC: 2,4-dibromo-6-[[cyclohexyl(methyl)amino]methyl]aniline;hydrochloride.