Methyl (4-nitrophenoxy)acetate
methyl 2-(4-nitrophenoxy)acetate
Also Known As: methyl 2-(4-nitrophenoxy)acetate|methyl (4-nitrophenoxy)acetate|Methyl 4-nitrophenoxyacetate|Oprea1_145451|methyl 4-nitro-phenoxyacetate|Methyl(4-Nitro phenoxy)acetate|methyl2-(4-nitrophenoxy)acetate|KS-00004DYV|Methyl (4-Nitro phenoxy)acetate|(4-Nitrophenoxy)acetic acid methyl ester|4-Nitrophenoxyacetic acid methyl ester|Acetic acid, 2-(4-nitrophenoxy)-, methyl ester|Acetic acid, (4-nitrophenoxy)-, methyl ester|4-Methoxycarbonylmethyloxy-nitrobenzene|(4-Nitro-phenoxy)-acetic acid methyl ester|SR-01000405611-1|Methyl 2-(4-Nitrophenoxy)acetate; Methyl p-Nitrophenoxyacetate; (4-Nitrophenoxy)acetic Acid Methyl Ester; (p-Nitrophenoxy)-acetic Acid Methyl Ester; (4-Nitrophenoxy)-acetic Acid Methyl Ester
| Molecular Formula | C9H9NO5 |
|---|---|
| Molecular Weight | 211.04807 g/mol |
| LogP | 1.8 |
| Topological Polar Surface Area | 81.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 211.04807 |
| Monoisotopic Mass | 211.04807 |
| Heavy Atoms | 15 |
| Complexity | 229.0 |
Chemical Identifiers
| CAS Number | 19786-48-2 |
|---|---|
| SMILES | COC(=O)COC1=CC=C(C=C1)[N+](=O)[O-] |
| InChIKey | ZZVXTAUUUUCLAG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl (4-nitrophenoxy)acetate (CAS 19786-48-2), with molecular formula C9H9NO5 and molecular weight 211.04807 g/mol. IUPAC: methyl 2-(4-nitrophenoxy)acetate.