AC1O5GPH
[(Z)-7-(dimethylazaniumyl)-4-[2-(2-phenylethyl)phenyl]hept-3-enyl]-dimethylazanium dichloride
Also Known As: C25H36N2.2ClH.1/2H2O|C25-H36-N2.2Cl-H.1/2H2-O|1,7-Bis(dimethylamino)-4-(2-(2-phenylethyl)phenyl)-3-heptene dihydrochloride hemihydrate|3-Heptene-1,7-diamine, 4-(o-phenethylphenyl)-N,N,N',N'-tetramethyl-, hydrochloride, hydrate (2:4:1)|4-(o-Phenethylphenyl)-N,N,N',N'-tetramethyl-3-heptene-1,7-diamine 2HCl hemihydrate|[(Z)-7-(dimethylazaniumyl)-4-(2-phenethylphenyl)hept-3-enyl]-dimethylazanium dichloride|3-HEPTENE-1,7-DIAMINE, 4-(o-PHENETHYLPHENYL)-N,N,N',N'-TETRAMETHYL-, HYDROCHLORI
| Molecular Formula | C25H38Cl2N2 |
|---|---|
| Molecular Weight | 436.2412 g/mol |
| LogP | -3.6775 |
| Topological Polar Surface Area | 8.88 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 11 |
| Exact Mass | 436.2412 |
| Monoisotopic Mass | 436.2412 |
| Heavy Atoms | 29 |
| Complexity | 696.9794 |
Chemical Identifiers
| CAS Number | 19947-07-0 |
|---|---|
| SMILES | C[NH+](C)CCC/C(=C/CC[NH+](C)C)/C1=CC=CC=C1CCC2=CC=CC=C2.[Cl-].[Cl-] |
Product Overview
AC1O5GPH (CAS 19947-07-0), with molecular formula C25H38Cl2N2 and molecular weight 436.2412 g/mol. IUPAC: [(Z)-7-(dimethylazaniumyl)-4-[2-(2-phenylethyl)phenyl]hept-3-enyl]-dimethylazanium dichloride.