trans 4-(4-Methoxy-benzyloxy)-but-2-en-1-ol
(E)-4-[(4-methoxyphenyl)methoxy]but-2-en-1-ol
Also Known As: 4-Methoxybenzyl(4-hydroxybut-2-enyl)ether|4-(4-Methoxybenzyloxy)-2-butene-1-ol|(E)-4-((4-methoxybenzyl)oxy)but-2-en-1-ol|4-[(4-Methoxybenzyl)oxy]-2-butene-1-ol|4-[(4-methoxyphenyl)methoxy]but-2-en-1-ol|(E)-4-(4-Methoxybenzyloxy)-2-butene-1-ol|J1.936.053I|J2.249.164D|trans 4-(4-methoxy-benzyloxy)-but-2-en-1-ol|(E)-4-[(4-methoxyphenyl)methoxy]but-2-en-1-ol|(2E)-4-[(4-Methoxybenzyl)oxy]-2-buten-1-ol #|(2E)-4-[(4-methoxyphenyl)methoxy]but-2-en-1-ol
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.10994 g/mol |
| LogP | 1.7603 |
| Topological Polar Surface Area | 38.69 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 208.10994 |
| Monoisotopic Mass | 208.10994 |
| Heavy Atoms | 15 |
| Complexity | 290.24048 |
Chemical Identifiers
| CAS Number | 199658-05-4 |
|---|---|
| SMILES | COC1=CC=C(C=C1)COC/C=C/CO |
Product Overview
trans 4-(4-Methoxy-benzyloxy)-but-2-en-1-ol (CAS 199658-05-4), with molecular formula C12H16O3 and molecular weight 208.10994 g/mol. IUPAC: (E)-4-[(4-methoxyphenyl)methoxy]but-2-en-1-ol.
trans 4-(4-Methoxy-benzyloxy)-but-2-en-1-ol is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »