6-Thiouric acid
6-sulfanylidene-7,9-dihydro-3H-purine-2,8-dione
Also Known As: 6-Thiouric acid|thiouric acid|6-Thiourate|Uric acid, 6-thio-|THIOURICACID|6-mercapto-2,8-purinediol|6-mercapto-9H-purine-2,8-diol|6-sulfanyl-9H-purine-2,8-diol|Uric acid, 6-thio- (VAN)|6-sulfanylidene-7,9-dihydro-3H-purine-2,8-dione|AI3-51991|2,8-DIHYDROXY-6-MERCAPTOPURINE|1H-Purine-2,8(3H,6H)-dione, 7,9-dihydro-6-thioxo-|SID:376229636|1H-Purine-2,6H)-dione, 7,9-dihydro-6-thioxo-|6-sulfanylidene-2,3,6,7,8,9-hexahydro-1H-purine-2,8-dione|7,9-Dihydro-6-thioxo-1H-purine-2,8(3H,6H)-dione|I14-23810|1,3,6,7-Tetrahydro-6-thioxo-2H-purine-2,8(9H)-dione|6-Sulfanylidene-7,9-dihydro-1H-purine-2,8(3H,6H)-dione
| Molecular Formula | C5H4N4O2S |
|---|---|
| Molecular Weight | 184.0055 g/mol |
| LogP | -0.39791 |
| Topological Polar Surface Area | 97.3 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 0 |
| Exact Mass | 184.0055 |
| Monoisotopic Mass | 184.0055 |
| Heavy Atoms | 12 |
| Complexity | 585.4945 |
Chemical Identifiers
| CAS Number | 2002-60-0 |
|---|---|
| SMILES | C12=C(NC(=O)N1)NC(=O)NC2=S |
Product Overview
6-Thiouric acid (CAS 2002-60-0), with molecular formula C5H4N4O2S and molecular weight 184.0055 g/mol. IUPAC: 6-sulfanylidene-7,9-dihydro-3H-purine-2,8-dione.