![{[(Trifluoromethyl)thio]ethynyl}benzene structure](/static/products/2002/2002-89-3.webp)
{[(Trifluoromethyl)thio]ethynyl}benzene
2-(trifluoromethylsulfanyl)ethynylbenzene
Also Known As: {[(trifluoromethyl)thio]ethynyl}benzene|Trifluoromethylthioethynylbenzene|2-(trifluoromethylsulfanyl)ethynylbenzene|Phenylethynyl(trifluoromethyl) sulfide|1-(Trifluoromethylthio)-2-phenylethyne|1-Phenyl-2-(trifluoromethylthio)ethyne|(Phenylethynyl)(trifluoromethyl) sulfide|[[(Trifluoromethyl)thio]ethynyl]benzene|[2-[(Trifluoromethyl)thio]ethynyl]benzene|{[(Trifluoromethyl)sulfanyl]ethynyl}benzene|benzene, [[(trifluoromethyl)thio]ethynyl]-|{2-[(trifluoromethyl)sulfanyl]ethynyl}benzene|J3.101.869B
| Molecular Formula | C9H5F3S |
|---|---|
| Molecular Weight | 202.00641 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 25.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 202.00641 |
| Monoisotopic Mass | 202.00641 |
| Heavy Atoms | 13 |
| Complexity | 214.0 |
Chemical Identifiers
| CAS Number | 2002-89-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)C#CSC(F)(F)F |
| InChIKey | XMGKHJYSXPUKNW-UHFFFAOYSA-N |
Product Overview
{[(Trifluoromethyl)thio]ethynyl}benzene (CAS 2002-89-3), with molecular formula C9H5F3S and molecular weight 202.00641 g/mol. IUPAC: 2-(trifluoromethylsulfanyl)ethynylbenzene.
{[(Trifluoromethyl)thio]ethynyl}benzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »