Methyl 3-(4-tert-butylphenyl)-3-oxopropanoate
methyl 3-(4-tert-butylphenyl)-3-oxopropanoate
Also Known As: methyl 3-(4-tert-butylphenyl)-3-oxopropanoate|Methyl 3-(4-(tert-butyl)phenyl)-3-oxopropanoate|3-(4-tert-Butyl-phenyl)-3-oxo-propionic acid methyl ester|3-(4-tert-butylphenyl)-3-oxo-propionic acidmethyl ester|Methyl 3-[4-(tert-Butyl)phenyl]-3-oxopropionate|J2.382.703D|methyl 3-(4-t-butylphenyl)-3-oxo-propanoate|methyl 3-(4-tert-butylphenyl)-3-oxo-propanoate|Methyl3-(4-(tert-butyl)phenyl)-3-oxopropanoate|3-(4-tert-Butylphenyl)-3-oxopropanoic acid methyl ester|3-Oxo-3-(4-tert-butylphenyl)propanoic acid methyl ester|3-(4-tert-butyl-phenyl)-3-oxo-propionic acidmethyl ester|3-(4-tert-butylphenyl)-3-oxo-propionic acid methyl ester|4-(1,1-dimethylethyl)-beta-oxo-benzenepropanoic acid methyl ester|Benzenepropanoic acid, 4-(1,1-dimethylethyl)-beta-oxo-, methyl ester
| Molecular Formula | C14H18O3 |
|---|---|
| Molecular Weight | 234.1256 g/mol |
| LogP | 2.7299 |
| Topological Polar Surface Area | 43.37 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 234.1256 |
| Monoisotopic Mass | 234.1256 |
| Heavy Atoms | 17 |
| Complexity | 410.08862 |
Chemical Identifiers
| CAS Number | 200280-57-5 |
|---|---|
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CC(=O)OC |
Product Overview
Methyl 3-(4-tert-butylphenyl)-3-oxopropanoate (CAS 200280-57-5), with molecular formula C14H18O3 and molecular weight 234.1256 g/mol. IUPAC: methyl 3-(4-tert-butylphenyl)-3-oxopropanoate.