3-Oxo-3-m-tolyl-propionic acid methyl ester
methyl 3-(3-methylphenyl)-3-oxopropanoate
Also Known As: Methyl 3-oxo-3-(m-tolyl)propanoate|3-Oxo-3-m-tolyl-propionic acid methyl ester|methyl 3-(3-methylphenyl)-3-oxopropanoate|Methyl 3-oxo-3-m-tolylpropanoate|3-Oxo-3-(3-tolyl)propionic acid methyl ester|Methyl 3-Oxo-3-(m-tolyl)propionate|Methyl3-oxo-3-(m-tolyl)propanoate|AB7592|methyl 3-(m-tolyl)-3-oxo-propanoate|3-Methyl-b-oxo-benzenepropanoic acid methyl ester|J2.926.957B|3-(3-Methylphenyl)-3-oxopropanoic acid methyl ester|3-Oxo-3-(3-tolyl)propanoic acid methyl ester
| Molecular Formula | C11H12O3 |
|---|---|
| Molecular Weight | 192.07864 g/mol |
| LogP | 1.74082 |
| Topological Polar Surface Area | 43.37 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 192.07864 |
| Monoisotopic Mass | 192.07864 |
| Heavy Atoms | 14 |
| Complexity | 355.3052 |
Chemical Identifiers
| CAS Number | 200404-35-9 |
|---|---|
| SMILES | CC1=CC(=CC=C1)C(=O)CC(=O)OC |
Product Overview
3-Oxo-3-m-tolyl-propionic acid methyl ester (CAS 200404-35-9), with molecular formula C11H12O3 and molecular weight 192.07864 g/mol. IUPAC: methyl 3-(3-methylphenyl)-3-oxopropanoate.
3-Oxo-3-m-tolyl-propionic acid methyl ester is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »