Benzoic acid, 4-chlorophenyl ester
(4-chlorophenyl) benzoate
Also Known As: 4-Chlorophenyl benzoate|Benzoic acid, 4-chlorophenyl ester|(4-chlorophenyl) benzoate|p-Chlorophenyl benzoate|p-Chlorophenol benzoate|4-chlorophenylbenzoate|p-Chlorophenyl=benzoate|ACMC-1CINA|Benzoic Acid 4-Chlorophenyl Ester|CBMicro_005244|Phenol, p-chloro-, benzoate|4-Chlorophenyl benzoate, 99%|Benzoic acid, p-chlorophenyl ester|benzoic acid (4-chlorophenyl) ester|Benzoic acid p-chlorophenyl ester|Benzoic acid,4-chlorophenyl ester|EINECS 217-910-0|BIM-0005214.P001|AI3-03807
| Molecular Formula | C13H9ClO2 |
|---|---|
| Molecular Weight | 232.02911 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 232.02911 |
| Monoisotopic Mass | 232.02911 |
| Heavy Atoms | 16 |
| Complexity | 228.0 |
Chemical Identifiers
| CAS Number | 2005-08-5 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)Cl |
| InChIKey | JKSIXXOEIXUYFW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzoic acid, 4-chlorophenyl ester (CAS 2005-08-5), with molecular formula C13H9ClO2 and molecular weight 232.02911 g/mol. IUPAC: (4-chlorophenyl) benzoate.